C17H20ClNOS — CID 63450802
3-chloro-N-[(4-methylsulfanylphenyl)methyl]-4-propoxyaniline (PubChem CID 63450802) has the molecular formula C17H20ClNOS and a molecular weight of 321.87 g/mol. Its IUPAC name is 3-chloro-N-[(4-methylsulfanylphenyl)methyl]-4-propoxyaniline.
| Compound Name | 3-chloro-N-[(4-methylsulfanylphenyl)methyl]-4-propoxyaniline |
|---|---|
| PubChem CID | 63450802 |
| Molecular Formula | C17H20ClNOS |
| Molecular Weight | 321.87 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-chloro-N-[(4-methylsulfanylphenyl)methyl]-4-propoxyaniline |
| SMILES | CCCOc1ccc(NCc2ccc(SC)cc2)cc1Cl |
| InChI | InChI=1S/C17H20ClNOS/c1-3-10-20-17-9-6-14(11-16(17)18)19-12-13-4-7-15(21-2)8-5-13/h4-9,11,19H,3,10,12H2,1-2H3 |
| InChIKey | ZVBJAUUOVCNVRU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.87 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|