C16H27NO — CID 63450883
N-(3,3-dimethylbutyl)-2-methyl-4-propan-2-yloxyaniline (PubChem CID 63450883) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-2-methyl-4-propan-2-yloxyaniline.
| Compound Name | N-(3,3-dimethylbutyl)-2-methyl-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 63450883 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-(3,3-dimethylbutyl)-2-methyl-4-propan-2-yloxyaniline |
| SMILES | Cc1cc(OC(C)C)ccc1NCCC(C)(C)C |
| InChI | InChI=1S/C16H27NO/c1-12(2)18-14-7-8-15(13(3)11-14)17-10-9-16(4,5)6/h7-8,11-12,17H,9-10H2,1-6H3 |
| InChIKey | HHDZHXKCZQALAU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|