C17H26N4 — CID 63450959
N-(5-methylheptan-3-yl)-3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline (PubChem CID 63450959) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-(5-methylheptan-3-yl)-3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline.
| Compound Name | N-(5-methylheptan-3-yl)-3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 63450959 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N-(5-methylheptan-3-yl)-3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline |
| SMILES | CCC(C)CC(CC)Nc1cccc(-c2n[nH]c(C)n2)c1 |
| InChI | InChI=1S/C17H26N4/c1-5-12(3)10-15(6-2)19-16-9-7-8-14(11-16)17-18-13(4)20-21-17/h7-9,11-12,15,19H,5-6,10H2,1-4H3,(H,18,20,21) |
| InChIKey | WXSAQAMDAOIHBV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |