C19H31N — CID 63452140
N-[(4-ethylcyclohexyl)methyl]-1-(4-ethylphenyl)ethanamine (PubChem CID 63452140) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is N-[(4-ethylcyclohexyl)methyl]-1-(4-ethylphenyl)ethanamine.
| Compound Name | N-[(4-ethylcyclohexyl)methyl]-1-(4-ethylphenyl)ethanamine |
|---|---|
| PubChem CID | 63452140 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | N-[(4-ethylcyclohexyl)methyl]-1-(4-ethylphenyl)ethanamine |
| SMILES | CCc1ccc(C(C)NCC2CCC(CC)CC2)cc1 |
| InChI | InChI=1S/C19H31N/c1-4-16-6-8-18(9-7-16)14-20-15(3)19-12-10-17(5-2)11-13-19/h10-13,15-16,18,20H,4-9,14H2,1-3H3 |
| InChIKey | MONAIDKWNHNOOX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |