About 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one
3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one (PubChem CID 634528) has the molecular formula C29H18F2O
and a molecular weight of 420.46 g/mol. Its IUPAC name is 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one.
Molecular Properties
| Compound Name | 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one |
| PubChem CID | 634528 |
| Molecular Formula | C29H18F2O |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one |
| SMILES | O=C1C(c2ccccc2)=C(c2ccc(F)cc2)C(c2ccc(F)cc2)=C1c1ccccc1 |
| InChI | InChI=1S/C29H18F2O/c30-23-15-11-21(12-16-23)25-26(22-13-17-24(31)18-14-22)28(20-9-5-2-6-10-20)29(32)27(25)19-7-3-1-4-8-19/h1-18H |
| InChIKey | VPXZKZUMSZRXCW-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one?
The IUPAC name of 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one (CID 634528) is 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one.
What is the SMILES notation for 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one?
The canonical SMILES for 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one is O=C1C(c2ccccc2)=C(c2ccc(F)cc2)C(c2ccc(F)cc2)=C1c1ccccc1.
What is the InChIKey of 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one?
The InChIKey is VPXZKZUMSZRXCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H18F2O/c30-23-15-11-21(12-16-23)25-26(22-13-17-24(31)18-14-22)28(20-9-5-2-6-10-20)29(32)27(25)19-7-3-1-4-8-19/h1-18H.
What are the key properties of 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one?
3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one has a molecular weight of 420.46 g/mol, XLogP of 7.07, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(4-fluorophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one is sourced from PubChem (CID 634528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).