About 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine
2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine (PubChem CID 634538) has the molecular formula C28H18F2N2
and a molecular weight of 420.46 g/mol. Its IUPAC name is 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine.
Molecular Properties
| Compound Name | 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine |
| PubChem CID | 634538 |
| Molecular Formula | C28H18F2N2 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine |
| SMILES | Fc1ccc(-c2nc(-c3ccccc3)c(-c3ccc(F)cc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H18F2N2/c29-23-15-11-21(12-16-23)27-25(19-7-3-1-4-8-19)31-28(22-13-17-24(30)18-14-22)26(32-27)20-9-5-2-6-10-20/h1-18H |
| InChIKey | JIBJUGKXZUYJST-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine?
The IUPAC name of 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine (CID 634538) is 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine.
What is the SMILES notation for 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine?
The canonical SMILES for 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine is Fc1ccc(-c2nc(-c3ccccc3)c(-c3ccc(F)cc3)nc2-c2ccccc2)cc1.
What is the InChIKey of 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine?
The InChIKey is JIBJUGKXZUYJST-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H18F2N2/c29-23-15-11-21(12-16-23)27-25(19-7-3-1-4-8-19)31-28(22-13-17-24(30)18-14-22)26(32-27)20-9-5-2-6-10-20/h1-18H.
What are the key properties of 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine?
2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine has a molecular weight of 420.46 g/mol, XLogP of 7.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(4-fluorophenyl)-3,6-diphenylpyrazine is sourced from PubChem (CID 634538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).