C22H46Si4 — CID 634556
[3,4-bis[ethyl(dimethyl)silyl]-1-[2-[ethyl(dimethyl)silyl]ethynyl]buta-1,2-dienyl]-ethyl-dimethylsilane (PubChem CID 634556) has the molecular formula C22H46Si4 and a molecular weight of 422.95 g/mol. Its IUPAC name is [3,4-bis[ethyl(dimethyl)silyl]-1-[2-[ethyl(dimethyl)silyl]ethynyl]buta-1,2-dienyl]-ethyl-dimethylsilane.
| Compound Name | [3,4-bis[ethyl(dimethyl)silyl]-1-[2-[ethyl(dimethyl)silyl]ethynyl]buta-1,2-dienyl]-ethyl-dimethylsilane |
|---|---|
| PubChem CID | 634556 |
| Molecular Formula | C22H46Si4 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | [3,4-bis[ethyl(dimethyl)silyl]-1-[2-[ethyl(dimethyl)silyl]ethynyl]buta-1,2-dienyl]-ethyl-dimethylsilane |
| SMILES | CC[Si](C)(C)C#CC(=C=C(C[Si](C)(C)CC)[Si](C)(C)CC)[Si](C)(C)CC |
| InChI | InChI=1S/C22H46Si4/c1-13-23(5,6)18-17-21(25(9,10)15-3)19-22(26(11,12)16-4)20-24(7,8)14-2/h13-16,20H2,1-12H3 |
| InChIKey | BDIPUZRCNPTSJI-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|