C12H13N3OS2 — CID 63457623
3-[5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]thiophen-2-yl]prop-2-yn-1-ol (PubChem CID 63457623) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 3-[5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]thiophen-2-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]thiophen-2-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 63457623 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 3-[5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]thiophen-2-yl]prop-2-yn-1-ol |
| SMILES | Cc1nnc(SCc2ccc(C#CCO)s2)n1C |
| InChI | InChI=1S/C12H13N3OS2/c1-9-13-14-12(15(9)2)17-8-11-6-5-10(18-11)4-3-7-16/h5-6,16H,7-8H2,1-2H3 |
| InChIKey | RMLJAFRPQHKQJJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|