C17H19BrO2 — CID 63457710
1-[(5-bromo-2-methoxyphenyl)methoxy]-2,3,5-trimethylbenzene (PubChem CID 63457710) has the molecular formula C17H19BrO2 and a molecular weight of 335.24 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)methoxy]-2,3,5-trimethylbenzene.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)methoxy]-2,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 63457710 |
| Molecular Formula | C17H19BrO2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)methoxy]-2,3,5-trimethylbenzene |
| SMILES | COc1ccc(Br)cc1COc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C17H19BrO2/c1-11-7-12(2)13(3)17(8-11)20-10-14-9-15(18)5-6-16(14)19-4/h5-9H,10H2,1-4H3 |
| InChIKey | AMJFBHYTKUZNNW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |