C13H22BrNS — CID 63458496
N-[(4-bromothiophen-2-yl)methyl]-N-butan-2-ylbutan-1-amine (PubChem CID 63458496) has the molecular formula C13H22BrNS and a molecular weight of 304.30 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N-butan-2-ylbutan-1-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N-butan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 63458496 |
| Molecular Formula | C13H22BrNS |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N-butan-2-ylbutan-1-amine |
| SMILES | CCCCN(Cc1cc(Br)cs1)C(C)CC |
| InChI | InChI=1S/C13H22BrNS/c1-4-6-7-15(11(3)5-2)9-13-8-12(14)10-16-13/h8,10-11H,4-7,9H2,1-3H3 |
| InChIKey | XYAKURSSMDRFJU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |