C17H25ClO — CID 63459510
1-chloro-2-[2-(3-methylbutoxy)ethyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 63459510) has the molecular formula C17H25ClO and a molecular weight of 280.84 g/mol. Its IUPAC name is 1-chloro-2-[2-(3-methylbutoxy)ethyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-chloro-2-[2-(3-methylbutoxy)ethyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63459510 |
| Molecular Formula | C17H25ClO |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-chloro-2-[2-(3-methylbutoxy)ethyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)CCOCCC1CCc2ccccc2C1Cl |
| InChI | InChI=1S/C17H25ClO/c1-13(2)9-11-19-12-10-15-8-7-14-5-3-4-6-16(14)17(15)18/h3-6,13,15,17H,7-12H2,1-2H3 |
| InChIKey | HQHOITFSFXGDOO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|