About 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine
4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine (PubChem CID 63460125) has the molecular formula C18H24BrNO
and a molecular weight of 350.30 g/mol. Its IUPAC name is 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine.
Molecular Properties
| Compound Name | 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine |
| PubChem CID | 63460125 |
| Molecular Formula | C18H24BrNO |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine |
| SMILES | CCC(N)C(Oc1ccc2ccccc2c1Br)C(C)(C)C |
| InChI | InChI=1S/C18H24BrNO/c1-5-14(20)17(18(2,3)4)21-15-11-10-12-8-6-7-9-13(12)16(15)19/h6-11,14,17H,5,20H2,1-4H3 |
| InChIKey | RDGVRFJAATZOPF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine?
The IUPAC name of 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine (CID 63460125) is 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine.
What is the SMILES notation for 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine?
The canonical SMILES for 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine is CCC(N)C(Oc1ccc2ccccc2c1Br)C(C)(C)C.
What is the InChIKey of 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine?
The InChIKey is RDGVRFJAATZOPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24BrNO/c1-5-14(20)17(18(2,3)4)21-15-11-10-12-8-6-7-9-13(12)16(15)19/h6-11,14,17H,5,20H2,1-4H3.
What are the key properties of 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine?
4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine has a molecular weight of 350.30 g/mol, XLogP of 5.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine is sourced from PubChem (CID 63460125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).