C18H24BrNO — CID 63460125
4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine (PubChem CID 63460125) has the molecular formula C18H24BrNO and a molecular weight of 350.30 g/mol. Its IUPAC name is 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine.
| Compound Name | 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 63460125 |
| Molecular Formula | C18H24BrNO |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 4-(1-bromonaphthalen-2-yl)oxy-5,5-dimethylhexan-3-amine |
| SMILES | CCC(N)C(Oc1ccc2ccccc2c1Br)C(C)(C)C |
| InChI | InChI=1S/C18H24BrNO/c1-5-14(20)17(18(2,3)4)21-15-11-10-12-8-6-7-9-13(12)16(15)19/h6-11,14,17H,5,20H2,1-4H3 |
| InChIKey | RDGVRFJAATZOPF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |