C18H21NO2 — CID 63462653
1,4-dimethyl-6,7,8,9,10,11-hexahydrocycloocta[b]quinoline-12-carboxylic acid (PubChem CID 63462653) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1,4-dimethyl-6,7,8,9,10,11-hexahydrocycloocta[b]quinoline-12-carboxylic acid.
| Compound Name | 1,4-dimethyl-6,7,8,9,10,11-hexahydrocycloocta[b]quinoline-12-carboxylic acid |
|---|---|
| PubChem CID | 63462653 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1,4-dimethyl-6,7,8,9,10,11-hexahydrocycloocta[b]quinoline-12-carboxylic acid |
| SMILES | Cc1ccc(C)c2c(C(=O)O)c3c(nc12)CCCCCC3 |
| InChI | InChI=1S/C18H21NO2/c1-11-9-10-12(2)17-15(11)16(18(20)21)13-7-5-3-4-6-8-14(13)19-17/h9-10H,3-8H2,1-2H3,(H,20,21) |
| InChIKey | YUTJVXIQKJXJBC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |