C16H15F2NO2 — CID 63463636
2-ethyl-6,8-difluoro-1,2,3,4-tetrahydroacridine-9-carboxylic acid (PubChem CID 63463636) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is 2-ethyl-6,8-difluoro-1,2,3,4-tetrahydroacridine-9-carboxylic acid.
| Compound Name | 2-ethyl-6,8-difluoro-1,2,3,4-tetrahydroacridine-9-carboxylic acid |
|---|---|
| PubChem CID | 63463636 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-ethyl-6,8-difluoro-1,2,3,4-tetrahydroacridine-9-carboxylic acid |
| SMILES | CCC1CCc2nc3cc(F)cc(F)c3c(C(=O)O)c2C1 |
| InChI | InChI=1S/C16H15F2NO2/c1-2-8-3-4-12-10(5-8)14(16(20)21)15-11(18)6-9(17)7-13(15)19-12/h6-8H,2-5H2,1H3,(H,20,21) |
| InChIKey | LNCDONBVDBLWNA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |