C15H12Cl2O3 — CID 63463861
2-[(3,4-dichlorophenyl)methoxy]-3-methylbenzoic acid (PubChem CID 63463861) has the molecular formula C15H12Cl2O3 and a molecular weight of 311.16 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methoxy]-3-methylbenzoic acid.
| Compound Name | 2-[(3,4-dichlorophenyl)methoxy]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 63463861 |
| Molecular Formula | C15H12Cl2O3 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methoxy]-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2O3/c1-9-3-2-4-11(15(18)19)14(9)20-8-10-5-6-12(16)13(17)7-10/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | LFRLEUWXSCFIOJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |