C17H27N3 — CID 63464264
N-amino-N'-cycloheptyl-3-(3-methylphenyl)propanimidamide (PubChem CID 63464264) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is N-amino-N'-cycloheptyl-3-(3-methylphenyl)propanimidamide.
| Compound Name | N-amino-N'-cycloheptyl-3-(3-methylphenyl)propanimidamide |
|---|---|
| PubChem CID | 63464264 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N-amino-N'-cycloheptyl-3-(3-methylphenyl)propanimidamide |
| SMILES | Cc1cccc(CC/C(=N\C2CCCCCC2)NN)c1 |
| InChI | InChI=1S/C17H27N3/c1-14-7-6-8-15(13-14)11-12-17(20-18)19-16-9-4-2-3-5-10-16/h6-8,13,16H,2-5,9-12,18H2,1H3,(H,19,20) |
| InChIKey | JAJCDNYKLNVMPY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|