About 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine
5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine (PubChem CID 63464475) has the molecular formula C14H21BrN2
and a molecular weight of 297.24 g/mol. Its IUPAC name is 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine.
Molecular Properties
| Compound Name | 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine |
| PubChem CID | 63464475 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine |
| SMILES | CCC1(CC)CCN(c2ccc(Br)cn2)CC1 |
| InChI | InChI=1S/C14H21BrN2/c1-3-14(4-2)7-9-17(10-8-14)13-6-5-12(15)11-16-13/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | ZHWPDYISYZDOSL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine?
The IUPAC name of 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine (CID 63464475) is 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine.
What is the SMILES notation for 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine?
The canonical SMILES for 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine is CCC1(CC)CCN(c2ccc(Br)cn2)CC1.
What is the InChIKey of 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine?
The InChIKey is ZHWPDYISYZDOSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrN2/c1-3-14(4-2)7-9-17(10-8-14)13-6-5-12(15)11-16-13/h5-6,11H,3-4,7-10H2,1-2H3.
What are the key properties of 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine?
5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine has a molecular weight of 297.24 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(4,4-diethylpiperidin-1-yl)pyridine is sourced from PubChem (CID 63464475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).