C13H25N5OS — CID 63464606
5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(propylamino)pentanamide (PubChem CID 63464606) has the molecular formula C13H25N5OS and a molecular weight of 299.44 g/mol. Its IUPAC name is 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(propylamino)pentanamide.
| Compound Name | 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(propylamino)pentanamide |
|---|---|
| PubChem CID | 63464606 |
| Molecular Formula | C13H25N5OS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(propylamino)pentanamide |
| SMILES | CCCNC(C)(CCCSc1nnc(C)n1C)C(N)=O |
| InChI | InChI=1S/C13H25N5OS/c1-5-8-15-13(3,11(14)19)7-6-9-20-12-17-16-10(2)18(12)4/h15H,5-9H2,1-4H3,(H2,14,19) |
| InChIKey | JGNXUBZYTODOFP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|