C19H25NO — CID 63464654
1-(4-butylphenyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 63464654) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-(4-butylphenyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-(4-butylphenyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 63464654 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-(4-butylphenyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | CCCCc1ccc(-n2c(C)cc3c2CCCC3O)cc1 |
| InChI | InChI=1S/C19H25NO/c1-3-4-6-15-9-11-16(12-10-15)20-14(2)13-17-18(20)7-5-8-19(17)21/h9-13,19,21H,3-8H2,1-2H3 |
| InChIKey | SPKHKNQZRWSZRA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|