About 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one
1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one (PubChem CID 63464979) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one.
Molecular Properties
| Compound Name | 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
| PubChem CID | 63464979 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
| SMILES | CCOc1cccc(-n2ccc3c2CC(C)(C)CC3=O)c1 |
| InChI | InChI=1S/C18H21NO2/c1-4-21-14-7-5-6-13(10-14)19-9-8-15-16(19)11-18(2,3)12-17(15)20/h5-10H,4,11-12H2,1-3H3 |
| InChIKey | BVCLPNAUXWNWBJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one?
The IUPAC name of 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one (CID 63464979) is 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one.
What is the SMILES notation for 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one?
The canonical SMILES for 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one is CCOc1cccc(-n2ccc3c2CC(C)(C)CC3=O)c1.
What is the InChIKey of 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one?
The InChIKey is BVCLPNAUXWNWBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-4-21-14-7-5-6-13(10-14)19-9-8-15-16(19)11-18(2,3)12-17(15)20/h5-10H,4,11-12H2,1-3H3.
What are the key properties of 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one?
1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one has a molecular weight of 283.37 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxyphenyl)-6,6-dimethyl-5,7-dihydroindol-4-one is sourced from PubChem (CID 63464979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).