C16H18INO — CID 63464993
1-(3-iodophenyl)-6,6-dimethyl-5,7-dihydro-4H-indol-4-ol (PubChem CID 63464993) has the molecular formula C16H18INO and a molecular weight of 367.23 g/mol. Its IUPAC name is 1-(3-iodophenyl)-6,6-dimethyl-5,7-dihydro-4H-indol-4-ol.
| Compound Name | 1-(3-iodophenyl)-6,6-dimethyl-5,7-dihydro-4H-indol-4-ol |
|---|---|
| PubChem CID | 63464993 |
| Molecular Formula | C16H18INO |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 1-(3-iodophenyl)-6,6-dimethyl-5,7-dihydro-4H-indol-4-ol |
| SMILES | CC1(C)Cc2c(ccn2-c2cccc(I)c2)C(O)C1 |
| InChI | InChI=1S/C16H18INO/c1-16(2)9-14-13(15(19)10-16)6-7-18(14)12-5-3-4-11(17)8-12/h3-8,15,19H,9-10H2,1-2H3 |
| InChIKey | BFCXEHNMXBJESM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|