About 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile
2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile (PubChem CID 63465258) has the molecular formula C18H27N3
and a molecular weight of 285.44 g/mol. Its IUPAC name is 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile.
Molecular Properties
| Compound Name | 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile |
| PubChem CID | 63465258 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile |
| SMILES | CC1Cc2ccccc2N(CCC(C)(C#N)NC(C)C)C1 |
| InChI | InChI=1S/C18H27N3/c1-14(2)20-18(4,13-19)9-10-21-12-15(3)11-16-7-5-6-8-17(16)21/h5-8,14-15,20H,9-12H2,1-4H3 |
| InChIKey | YAWDLJKPSMEEKF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile?
The IUPAC name of 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile (CID 63465258) is 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile.
What is the SMILES notation for 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile?
The canonical SMILES for 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile is CC1Cc2ccccc2N(CCC(C)(C#N)NC(C)C)C1.
What is the InChIKey of 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile?
The InChIKey is YAWDLJKPSMEEKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3/c1-14(2)20-18(4,13-19)9-10-21-12-15(3)11-16-7-5-6-8-17(16)21/h5-8,14-15,20H,9-12H2,1-4H3.
What are the key properties of 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile?
2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile has a molecular weight of 285.44 g/mol, XLogP of 3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(propan-2-ylamino)butanenitrile is sourced from PubChem (CID 63465258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).