About 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one
1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one (PubChem CID 63465339) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
| PubChem CID | 63465339 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
| SMILES | CC1(C)CC(=O)c2ccn(CC3CCCCC3)c2C1 |
| InChI | InChI=1S/C17H25NO/c1-17(2)10-15-14(16(19)11-17)8-9-18(15)12-13-6-4-3-5-7-13/h8-9,13H,3-7,10-12H2,1-2H3 |
| InChIKey | BXVPBGXFQRFZDX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one?
The IUPAC name of 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one (CID 63465339) is 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one.
What is the SMILES notation for 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one?
The canonical SMILES for 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one is CC1(C)CC(=O)c2ccn(CC3CCCCC3)c2C1.
What is the InChIKey of 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one?
The InChIKey is BXVPBGXFQRFZDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO/c1-17(2)10-15-14(16(19)11-17)8-9-18(15)12-13-6-4-3-5-7-13/h8-9,13H,3-7,10-12H2,1-2H3.
What are the key properties of 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one?
1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one has a molecular weight of 259.39 g/mol, XLogP of 4.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)-6,6-dimethyl-5,7-dihydroindol-4-one is sourced from PubChem (CID 63465339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).