C17H20ClNO — CID 63465888
1-(2-chlorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol (PubChem CID 63465888) has the molecular formula C17H20ClNO and a molecular weight of 289.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol.
| Compound Name | 1-(2-chlorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol |
|---|---|
| PubChem CID | 63465888 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-(2-chlorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol |
| SMILES | Cc1cc2c(n1-c1ccccc1Cl)CC(C)(C)CC2O |
| InChI | InChI=1S/C17H20ClNO/c1-11-8-12-15(9-17(2,3)10-16(12)20)19(11)14-7-5-4-6-13(14)18/h4-8,16,20H,9-10H2,1-3H3 |
| InChIKey | ZCDMUFQGMLWILD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|