About 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol
6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol (PubChem CID 63466062) has the molecular formula C19H25NO
and a molecular weight of 283.42 g/mol. Its IUPAC name is 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol.
Molecular Properties
| Compound Name | 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol |
| PubChem CID | 63466062 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol |
| SMILES | CC(C)c1ccccc1-n1ccc2c1CC(C)(C)CC2O |
| InChI | InChI=1S/C19H25NO/c1-13(2)14-7-5-6-8-16(14)20-10-9-15-17(20)11-19(3,4)12-18(15)21/h5-10,13,18,21H,11-12H2,1-4H3 |
| InChIKey | VCVZAGBVXDNDFZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol?
The IUPAC name of 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol (CID 63466062) is 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol.
What is the SMILES notation for 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol?
The canonical SMILES for 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol is CC(C)c1ccccc1-n1ccc2c1CC(C)(C)CC2O.
What is the InChIKey of 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol?
The InChIKey is VCVZAGBVXDNDFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO/c1-13(2)14-7-5-6-8-16(14)20-10-9-15-17(20)11-19(3,4)12-18(15)21/h5-10,13,18,21H,11-12H2,1-4H3.
What are the key properties of 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol?
6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol has a molecular weight of 283.42 g/mol, XLogP of 4.61, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1-(2-propan-2-ylphenyl)-5,7-dihydro-4H-indol-4-ol is sourced from PubChem (CID 63466062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).