C18H24N2 — CID 63466097
2-methyl-1-(3-propan-2-ylphenyl)-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 63466097) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-methyl-1-(3-propan-2-ylphenyl)-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 2-methyl-1-(3-propan-2-ylphenyl)-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 63466097 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-methyl-1-(3-propan-2-ylphenyl)-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | Cc1cc2c(n1-c1cccc(C(C)C)c1)CCCC2N |
| InChI | InChI=1S/C18H24N2/c1-12(2)14-6-4-7-15(11-14)20-13(3)10-16-17(19)8-5-9-18(16)20/h4,6-7,10-12,17H,5,8-9,19H2,1-3H3 |
| InChIKey | DZCXAVPYYNYPMF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|