About 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine
1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine (PubChem CID 63466428) has the molecular formula C18H32N2
and a molecular weight of 276.47 g/mol. Its IUPAC name is 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine |
| PubChem CID | 63466428 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine |
| SMILES | CCN(CC(NC)C12CC3CC(CC(C3)C1)C2)C1CC1 |
| InChI | InChI=1S/C18H32N2/c1-3-20(16-4-5-16)12-17(19-2)18-9-13-6-14(10-18)8-15(7-13)11-18/h13-17,19H,3-12H2,1-2H3 |
| InChIKey | WETFJFJKNINXAK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine?
The IUPAC name of 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine (CID 63466428) is 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine.
What is the SMILES notation for 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine?
The canonical SMILES for 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine is CCN(CC(NC)C12CC3CC(CC(C3)C1)C2)C1CC1.
What is the InChIKey of 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine?
The InChIKey is WETFJFJKNINXAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2/c1-3-20(16-4-5-16)12-17(19-2)18-9-13-6-14(10-18)8-15(7-13)11-18/h13-17,19H,3-12H2,1-2H3.
What are the key properties of 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine?
1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine has a molecular weight of 276.47 g/mol, XLogP of 3.28, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-N'-cyclopropyl-N'-ethyl-N-methylethane-1,2-diamine is sourced from PubChem (CID 63466428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).