C13H24N4O2S — CID 63466749
5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(propylamino)pentanoic acid (PubChem CID 63466749) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(propylamino)pentanoic acid.
| Compound Name | 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(propylamino)pentanoic acid |
|---|---|
| PubChem CID | 63466749 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(propylamino)pentanoic acid |
| SMILES | CCCNC(C)(CCCSc1nnc(C)n1C)C(=O)O |
| InChI | InChI=1S/C13H24N4O2S/c1-5-8-14-13(3,11(18)19)7-6-9-20-12-16-15-10(2)17(12)4/h14H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | BCXHOKZDCLWLRT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|