C17H20Cl2N2 — CID 63466785
1-(2,4-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine (PubChem CID 63466785) has the molecular formula C17H20Cl2N2 and a molecular weight of 323.27 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine |
|---|---|
| PubChem CID | 63466785 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine |
| SMILES | Cc1cc2c(n1-c1ccc(Cl)cc1Cl)CC(C)(C)CC2N |
| InChI | InChI=1S/C17H20Cl2N2/c1-10-6-12-14(20)8-17(2,3)9-16(12)21(10)15-5-4-11(18)7-13(15)19/h4-7,14H,8-9,20H2,1-3H3 |
| InChIKey | LFGFPGNJNKNIFK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|