About 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine
2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine (PubChem CID 63467863) has the molecular formula C17H24N4
and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine.
Molecular Properties
| Compound Name | 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine |
| PubChem CID | 63467863 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine |
| SMILES | Cc1cc(C)cc(-c2nc(C3CCCCC3)n(N)c2N)c1 |
| InChI | InChI=1S/C17H24N4/c1-11-8-12(2)10-14(9-11)15-16(18)21(19)17(20-15)13-6-4-3-5-7-13/h8-10,13H,3-7,18-19H2,1-2H3 |
| InChIKey | UCNJMMWAFXBJKA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine?
The IUPAC name of 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine (CID 63467863) is 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine.
What is the SMILES notation for 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine?
The canonical SMILES for 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine is Cc1cc(C)cc(-c2nc(C3CCCCC3)n(N)c2N)c1.
What is the InChIKey of 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine?
The InChIKey is UCNJMMWAFXBJKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4/c1-11-8-12(2)10-14(9-11)15-16(18)21(19)17(20-15)13-6-4-3-5-7-13/h8-10,13H,3-7,18-19H2,1-2H3.
What are the key properties of 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine?
2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine has a molecular weight of 284.41 g/mol, XLogP of 3.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-4-(3,5-dimethylphenyl)imidazole-1,5-diamine is sourced from PubChem (CID 63467863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).