C7H12N3+ — CID 6346859
[amino-(1,5-dimethylpyrrol-2-yl)methylidene]azanium (PubChem CID 6346859) has the molecular formula C7H12N3+ and a molecular weight of 138.19 g/mol. Its IUPAC name is [amino-(1,5-dimethylpyrrol-2-yl)methylidene]azanium.
| Compound Name | [amino-(1,5-dimethylpyrrol-2-yl)methylidene]azanium |
|---|---|
| PubChem CID | 6346859 |
| Molecular Formula | C7H12N3+ |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | [amino-(1,5-dimethylpyrrol-2-yl)methylidene]azanium |
| SMILES | Cc1ccc(C(N)=[NH2+])n1C |
| InChI | InChI=1S/C7H11N3/c1-5-3-4-6(7(8)9)10(5)2/h3-4H,1-2H3,(H3,8,9)/p+1 |
| InChIKey | ZJGZSOPQLOXMAO-UHFFFAOYSA-O |
| XLogP | -1.20 |
| TPSA | 56.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|