About 1-aminobutylideneazanium
1-aminobutylideneazanium (PubChem CID 6346884) has the molecular formula C4H11N2+
and a molecular weight of 87.15 g/mol. Its IUPAC name is 1-aminobutylideneazanium.
Molecular Properties
| Compound Name | 1-aminobutylideneazanium |
| PubChem CID | 6346884 |
| Molecular Formula | C4H11N2+ |
| Molecular Weight | 87.15 g/mol |
| Exact Mass | 87.09 |
| IUPAC Name | 1-aminobutylideneazanium |
| SMILES | CCCC(N)=[NH2+] |
| InChI | InChI=1S/C4H10N2/c1-2-3-4(5)6/h2-3H2,1H3,(H3,5,6)/p+1 |
| InChIKey | RXKUYBRRTKRGME-UHFFFAOYSA-O |
| XLogP | -1.10 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.15 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminobutylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminobutylideneazanium?
The IUPAC name of 1-aminobutylideneazanium (CID 6346884) is 1-aminobutylideneazanium.
What is the SMILES notation for 1-aminobutylideneazanium?
The canonical SMILES for 1-aminobutylideneazanium is CCCC(N)=[NH2+].
What is the InChIKey of 1-aminobutylideneazanium?
The InChIKey is RXKUYBRRTKRGME-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H10N2/c1-2-3-4(5)6/h2-3H2,1H3,(H3,5,6)/p+1.
What are the key properties of 1-aminobutylideneazanium?
1-aminobutylideneazanium has a molecular weight of 87.15 g/mol, XLogP of -1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminobutylideneazanium is sourced from PubChem (CID 6346884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).