C18H31FN2 — CID 63470423
2-N-[(2-fluorophenyl)methyl]-2-N,2-dimethylnonane-1,2-diamine (PubChem CID 63470423) has the molecular formula C18H31FN2 and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-N-[(2-fluorophenyl)methyl]-2-N,2-dimethylnonane-1,2-diamine.
| Compound Name | 2-N-[(2-fluorophenyl)methyl]-2-N,2-dimethylnonane-1,2-diamine |
|---|---|
| PubChem CID | 63470423 |
| Molecular Formula | C18H31FN2 |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 2-N-[(2-fluorophenyl)methyl]-2-N,2-dimethylnonane-1,2-diamine |
| SMILES | CCCCCCCC(C)(CN)N(C)Cc1ccccc1F |
| InChI | InChI=1S/C18H31FN2/c1-4-5-6-7-10-13-18(2,15-20)21(3)14-16-11-8-9-12-17(16)19/h8-9,11-12H,4-7,10,13-15,20H2,1-3H3 |
| InChIKey | FCYOUDMPOGQDDY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|