C18H32N2S — CID 63470809
2-N-cyclopropyl-2-methyl-2-N-(thiophen-3-ylmethyl)nonane-1,2-diamine (PubChem CID 63470809) has the molecular formula C18H32N2S and a molecular weight of 308.54 g/mol. Its IUPAC name is 2-N-cyclopropyl-2-methyl-2-N-(thiophen-3-ylmethyl)nonane-1,2-diamine.
| Compound Name | 2-N-cyclopropyl-2-methyl-2-N-(thiophen-3-ylmethyl)nonane-1,2-diamine |
|---|---|
| PubChem CID | 63470809 |
| Molecular Formula | C18H32N2S |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2-N-cyclopropyl-2-methyl-2-N-(thiophen-3-ylmethyl)nonane-1,2-diamine |
| SMILES | CCCCCCCC(C)(CN)N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C18H32N2S/c1-3-4-5-6-7-11-18(2,15-19)20(17-8-9-17)13-16-10-12-21-14-16/h10,12,14,17H,3-9,11,13,15,19H2,1-2H3 |
| InChIKey | KRIKRFUMKDSOKO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|