C7H5F4N2+ — CID 6347219
[amino-(2,3,4,5-tetrafluorophenyl)methylidene]azanium (PubChem CID 6347219) has the molecular formula C7H5F4N2+ and a molecular weight of 193.12 g/mol. Its IUPAC name is [amino-(2,3,4,5-tetrafluorophenyl)methylidene]azanium.
| Compound Name | [amino-(2,3,4,5-tetrafluorophenyl)methylidene]azanium |
|---|---|
| PubChem CID | 6347219 |
| Molecular Formula | C7H5F4N2+ |
| Molecular Weight | 193.12 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | [amino-(2,3,4,5-tetrafluorophenyl)methylidene]azanium |
| SMILES | NC(=[NH2+])c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H4F4N2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1H,(H3,12,13)/p+1 |
| InChIKey | GWGYDRLEQHDALW-UHFFFAOYSA-O |
| XLogP | -0.29 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.12 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|