C14H18ClF3 — CID 63472261
1-[2-(1-chloroethyl)-3-methylbutyl]-4-(trifluoromethyl)benzene (PubChem CID 63472261) has the molecular formula C14H18ClF3 and a molecular weight of 278.75 g/mol. Its IUPAC name is 1-[2-(1-chloroethyl)-3-methylbutyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[2-(1-chloroethyl)-3-methylbutyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 63472261 |
| Molecular Formula | C14H18ClF3 |
| Molecular Weight | 278.75 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1-[2-(1-chloroethyl)-3-methylbutyl]-4-(trifluoromethyl)benzene |
| SMILES | CC(C)C(Cc1ccc(C(F)(F)F)cc1)C(C)Cl |
| InChI | InChI=1S/C14H18ClF3/c1-9(2)13(10(3)15)8-11-4-6-12(7-5-11)14(16,17)18/h4-7,9-10,13H,8H2,1-3H3 |
| InChIKey | BIUDWKLFLRAWFU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|