C8H8F4N4+2 — CID 6347331
[amino-[4-[amino(azaniumylidene)methyl]-2,3,5,6-tetrafluorophenyl]methylidene]azanium (PubChem CID 6347331) has the molecular formula C8H8F4N4+2 and a molecular weight of 236.17 g/mol. Its IUPAC name is [amino-[4-[amino(azaniumylidene)methyl]-2,3,5,6-tetrafluorophenyl]methylidene]azanium.
| Compound Name | [amino-[4-[amino(azaniumylidene)methyl]-2,3,5,6-tetrafluorophenyl]methylidene]azanium |
|---|---|
| PubChem CID | 6347331 |
| Molecular Formula | C8H8F4N4+2 |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [amino-[4-[amino(azaniumylidene)methyl]-2,3,5,6-tetrafluorophenyl]methylidene]azanium |
| SMILES | NC(=[NH2+])c1c(F)c(F)c(C(N)=[NH2+])c(F)c1F |
| InChI | InChI=1S/C8H6F4N4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H3,13,14)(H3,15,16)/p+2 |
| InChIKey | KMUBDCOLCJILAB-UHFFFAOYSA-P |
| XLogP | -2.83 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|