C19H21Br — CID 63473353
1-bromo-2-[(3,5-dimethylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 63473353) has the molecular formula C19H21Br and a molecular weight of 329.28 g/mol. Its IUPAC name is 1-bromo-2-[(3,5-dimethylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-bromo-2-[(3,5-dimethylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63473353 |
| Molecular Formula | C19H21Br |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-bromo-2-[(3,5-dimethylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1cc(C)cc(CC2CCc3ccccc3C2Br)c1 |
| InChI | InChI=1S/C19H21Br/c1-13-9-14(2)11-15(10-13)12-17-8-7-16-5-3-4-6-18(16)19(17)20/h3-6,9-11,17,19H,7-8,12H2,1-2H3 |
| InChIKey | YLXYHHKZUPPKPV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|