C18H22FNO — CID 63473815
1-(3,4-dimethylphenyl)-N-ethyl-2-(4-fluorophenoxy)ethanamine (PubChem CID 63473815) has the molecular formula C18H22FNO and a molecular weight of 287.38 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N-ethyl-2-(4-fluorophenoxy)ethanamine.
| Compound Name | 1-(3,4-dimethylphenyl)-N-ethyl-2-(4-fluorophenoxy)ethanamine |
|---|---|
| PubChem CID | 63473815 |
| Molecular Formula | C18H22FNO |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N-ethyl-2-(4-fluorophenoxy)ethanamine |
| SMILES | CCNC(COc1ccc(F)cc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H22FNO/c1-4-20-18(15-6-5-13(2)14(3)11-15)12-21-17-9-7-16(19)8-10-17/h5-11,18,20H,4,12H2,1-3H3 |
| InChIKey | XSYVLFOUFXZBEU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |