About N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine
N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine (PubChem CID 63475619) has the molecular formula C18H37NO
and a molecular weight of 283.50 g/mol. Its IUPAC name is N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine.
Molecular Properties
| Compound Name | N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine |
| PubChem CID | 63475619 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine |
| SMILES | CCCNC(C)CCCCOC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C18H37NO/c1-6-10-19-16(3)9-7-8-11-20-17-12-15(2)13-18(4,5)14-17/h15-17,19H,6-14H2,1-5H3 |
| InChIKey | ATOMPKGSBWMGRL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine?
The IUPAC name of N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine (CID 63475619) is N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine.
What is the SMILES notation for N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine?
The canonical SMILES for N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine is CCCNC(C)CCCCOC1CC(C)CC(C)(C)C1.
What is the InChIKey of N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine?
The InChIKey is ATOMPKGSBWMGRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO/c1-6-10-19-16(3)9-7-8-11-20-17-12-15(2)13-18(4,5)14-17/h15-17,19H,6-14H2,1-5H3.
What are the key properties of N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine?
N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine has a molecular weight of 283.50 g/mol, XLogP of 4.78, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-6-(3,3,5-trimethylcyclohexyl)oxyhexan-2-amine is sourced from PubChem (CID 63475619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).