C17H27BrO — CID 63475657
1-[2-bromo-1-(2-ethylhexoxy)ethyl]-3-methylbenzene (PubChem CID 63475657) has the molecular formula C17H27BrO and a molecular weight of 327.31 g/mol. Its IUPAC name is 1-[2-bromo-1-(2-ethylhexoxy)ethyl]-3-methylbenzene.
| Compound Name | 1-[2-bromo-1-(2-ethylhexoxy)ethyl]-3-methylbenzene |
|---|---|
| PubChem CID | 63475657 |
| Molecular Formula | C17H27BrO |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[2-bromo-1-(2-ethylhexoxy)ethyl]-3-methylbenzene |
| SMILES | CCCCC(CC)COC(CBr)c1cccc(C)c1 |
| InChI | InChI=1S/C17H27BrO/c1-4-6-9-15(5-2)13-19-17(12-18)16-10-7-8-14(3)11-16/h7-8,10-11,15,17H,4-6,9,12-13H2,1-3H3 |
| InChIKey | CFEKLCBRUIIMLH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|