C15H9ClF3NS — CID 63476646
N-[(3-chloro-1-benzothiophen-2-yl)methyl]-2,4,5-trifluoroaniline (PubChem CID 63476646) has the molecular formula C15H9ClF3NS and a molecular weight of 327.76 g/mol. Its IUPAC name is N-[(3-chloro-1-benzothiophen-2-yl)methyl]-2,4,5-trifluoroaniline.
| Compound Name | N-[(3-chloro-1-benzothiophen-2-yl)methyl]-2,4,5-trifluoroaniline |
|---|---|
| PubChem CID | 63476646 |
| Molecular Formula | C15H9ClF3NS |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | N-[(3-chloro-1-benzothiophen-2-yl)methyl]-2,4,5-trifluoroaniline |
| SMILES | Fc1cc(F)c(NCc2sc3ccccc3c2Cl)cc1F |
| InChI | InChI=1S/C15H9ClF3NS/c16-15-8-3-1-2-4-13(8)21-14(15)7-20-12-6-10(18)9(17)5-11(12)19/h1-6,20H,7H2 |
| InChIKey | NOVROZFIDNEWKM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|