About 3,6-diiodoacridine
3,6-diiodoacridine (PubChem CID 634773) has the molecular formula C13H7I2N
and a molecular weight of 431.01 g/mol. Its IUPAC name is 3,6-diiodoacridine.
Molecular Properties
| Compound Name | 3,6-diiodoacridine |
| PubChem CID | 634773 |
| Molecular Formula | C13H7I2N |
| Molecular Weight | 431.01 g/mol |
| Exact Mass | 430.87 |
| IUPAC Name | 3,6-diiodoacridine |
| SMILES | Ic1ccc2cc3ccc(I)cc3nc2c1 |
| InChI | InChI=1S/C13H7I2N/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10/h1-7H |
| InChIKey | FVRZQWKXNDPTOJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.01 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diiodoacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diiodoacridine?
The IUPAC name of 3,6-diiodoacridine (CID 634773) is 3,6-diiodoacridine.
What is the SMILES notation for 3,6-diiodoacridine?
The canonical SMILES for 3,6-diiodoacridine is Ic1ccc2cc3ccc(I)cc3nc2c1.
What is the InChIKey of 3,6-diiodoacridine?
The InChIKey is FVRZQWKXNDPTOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7I2N/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10/h1-7H.
What are the key properties of 3,6-diiodoacridine?
3,6-diiodoacridine has a molecular weight of 431.01 g/mol, XLogP of 4.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diiodoacridine is sourced from PubChem (CID 634773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).