About (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol
(3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol (PubChem CID 6347761) has the molecular formula C7H15NO4S
and a molecular weight of 209.27 g/mol. Its IUPAC name is (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol |
| PubChem CID | 6347761 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol |
| SMILES | COCCN[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C7H15NO4S/c1-12-3-2-8-6-4-13(10,11)5-7(6)9/h6-9H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | MCKNDMCUGIAFNF-RNFRBKRXSA-N |
| XLogP | -1.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol?
The IUPAC name of (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol (CID 6347761) is (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol.
What is the SMILES notation for (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol?
The canonical SMILES for (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol is COCCN[C@@H]1CS(=O)(=O)C[C@H]1O.
What is the InChIKey of (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol?
The InChIKey is MCKNDMCUGIAFNF-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H15NO4S/c1-12-3-2-8-6-4-13(10,11)5-7(6)9/h6-9H,2-5H2,1H3/t6-,7-/m1/s1.
What are the key properties of (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol?
(3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol has a molecular weight of 209.27 g/mol, XLogP of -1.62, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 6347761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).