About N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine
N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine (PubChem CID 63477972) has the molecular formula C15H31N
and a molecular weight of 225.42 g/mol. Its IUPAC name is N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine |
| PubChem CID | 63477972 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine |
| SMILES | CCCCC(C)NC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H31N/c1-6-7-8-13(3)16-14-9-12(2)10-15(4,5)11-14/h12-14,16H,6-11H2,1-5H3 |
| InChIKey | VAUCWOMNXVLVAA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine?
The IUPAC name of N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine (CID 63477972) is N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine.
What is the SMILES notation for N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine?
The canonical SMILES for N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine is CCCCC(C)NC1CC(C)CC(C)(C)C1.
What is the InChIKey of N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine?
The InChIKey is VAUCWOMNXVLVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N/c1-6-7-8-13(3)16-14-9-12(2)10-15(4,5)11-14/h12-14,16H,6-11H2,1-5H3.
What are the key properties of N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine?
N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine has a molecular weight of 225.42 g/mol, XLogP of 4.37, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexan-2-yl-3,3,5-trimethylcyclohexan-1-amine is sourced from PubChem (CID 63477972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).