C17H19Cl2NO — CID 63478157
3-butan-2-yloxy-N-[(2,6-dichlorophenyl)methyl]aniline (PubChem CID 63478157) has the molecular formula C17H19Cl2NO and a molecular weight of 324.25 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-[(2,6-dichlorophenyl)methyl]aniline.
| Compound Name | 3-butan-2-yloxy-N-[(2,6-dichlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 63478157 |
| Molecular Formula | C17H19Cl2NO |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-butan-2-yloxy-N-[(2,6-dichlorophenyl)methyl]aniline |
| SMILES | CCC(C)Oc1cccc(NCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C17H19Cl2NO/c1-3-12(2)21-14-7-4-6-13(10-14)20-11-15-16(18)8-5-9-17(15)19/h4-10,12,20H,3,11H2,1-2H3 |
| InChIKey | BQVBPYFQVBZAHW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |