C17H24BrNO — CID 63478976
N-[(5-bromo-2-propoxyphenyl)methyl]-1-cyclohex-3-en-1-ylmethanamine (PubChem CID 63478976) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is N-[(5-bromo-2-propoxyphenyl)methyl]-1-cyclohex-3-en-1-ylmethanamine.
| Compound Name | N-[(5-bromo-2-propoxyphenyl)methyl]-1-cyclohex-3-en-1-ylmethanamine |
|---|---|
| PubChem CID | 63478976 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[(5-bromo-2-propoxyphenyl)methyl]-1-cyclohex-3-en-1-ylmethanamine |
| SMILES | CCCOc1ccc(Br)cc1CNCC1CC=CCC1 |
| InChI | InChI=1S/C17H24BrNO/c1-2-10-20-17-9-8-16(18)11-15(17)13-19-12-14-6-4-3-5-7-14/h3-4,8-9,11,14,19H,2,5-7,10,12-13H2,1H3 |
| InChIKey | KBYIPRWVAWEZAR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|