C16H20Cl2N2 — CID 63479601
2-tert-butyl-7,8-dichloro-N-propylquinolin-4-amine (PubChem CID 63479601) has the molecular formula C16H20Cl2N2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 2-tert-butyl-7,8-dichloro-N-propylquinolin-4-amine.
| Compound Name | 2-tert-butyl-7,8-dichloro-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 63479601 |
| Molecular Formula | C16H20Cl2N2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-tert-butyl-7,8-dichloro-N-propylquinolin-4-amine |
| SMILES | CCCNc1cc(C(C)(C)C)nc2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C16H20Cl2N2/c1-5-8-19-12-9-13(16(2,3)4)20-15-10(12)6-7-11(17)14(15)18/h6-7,9H,5,8H2,1-4H3,(H,19,20) |
| InChIKey | HDRUFIGPKIEQST-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |