C16H19Cl2N3 — CID 63479985
2-(3,4-dichlorophenyl)-N,6-dipropylpyrimidin-4-amine (PubChem CID 63479985) has the molecular formula C16H19Cl2N3 and a molecular weight of 324.26 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N,6-dipropylpyrimidin-4-amine.
| Compound Name | 2-(3,4-dichlorophenyl)-N,6-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63479985 |
| Molecular Formula | C16H19Cl2N3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N,6-dipropylpyrimidin-4-amine |
| SMILES | CCCNc1cc(CCC)nc(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H19Cl2N3/c1-3-5-12-10-15(19-8-4-2)21-16(20-12)11-6-7-13(17)14(18)9-11/h6-7,9-10H,3-5,8H2,1-2H3,(H,19,20,21) |
| InChIKey | LMXHDIYLUVZSEQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |