C16H19Cl2N3 — CID 63480501
2-(3,5-dichlorophenyl)-6-propan-2-yl-N-propylpyrimidin-4-amine (PubChem CID 63480501) has the molecular formula C16H19Cl2N3 and a molecular weight of 324.26 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-6-propan-2-yl-N-propylpyrimidin-4-amine.
| Compound Name | 2-(3,5-dichlorophenyl)-6-propan-2-yl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63480501 |
| Molecular Formula | C16H19Cl2N3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-6-propan-2-yl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(C(C)C)nc(-c2cc(Cl)cc(Cl)c2)n1 |
| InChI | InChI=1S/C16H19Cl2N3/c1-4-5-19-15-9-14(10(2)3)20-16(21-15)11-6-12(17)8-13(18)7-11/h6-10H,4-5H2,1-3H3,(H,19,20,21) |
| InChIKey | YNXWGHANEWDRHY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |